|
|
| | 2-(2-hydroxyphenyl)isoindole-1,3-dione Basic information |
| Product Name: | 2-(2-hydroxyphenyl)isoindole-1,3-dione | | Synonyms: | 2-(2-Hydroxyphenyl)-1H-isoindole-1,3(2H)-dione;2-(2-hydroxyphenyl)-2,3-dihydro-1H-isoindole-1,3-dione;1H-Isoindole-1,3(2H)-dione, 2-(2-hydroxyphenyl)-;2-(2-Hydroxyphenyl)isoindoline-1,3-dione;2-(2-Hydroxyphenyl)-1H-isoindole-1,3(2H)-dione | | CAS: | 6307-13-7 | | MF: | C14H9NO3 | | MW: | 239.23 | | EINECS: | | | Product Categories: | | | Mol File: | 6307-13-7.mol |  |
| | 2-(2-hydroxyphenyl)isoindole-1,3-dione Chemical Properties |
| form | solid | | InChI | 1S/C14H9NO3/c16-12-8-4-3-7-11(12)15-13(17)9-5-1-2-6-10(9)14(15)18/h1-8,16H | | InChIKey | JLBSEGLKCFPNGS-UHFFFAOYSA-N | | SMILES | N2(C(=O)c3c(cccc3)C2=O)c1c(cccc1)O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(2-hydroxyphenyl)isoindole-1,3-dione Usage And Synthesis |
| | 2-(2-hydroxyphenyl)isoindole-1,3-dione Preparation Products And Raw materials |
|