- 2-Ethylbenzofuran
-
- $1.00 / 1KG
-
2024-07-07
- CAS:3131-63-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- 2-Ethylbenzofuran
-
- $1.00 / 25KG
-
2022-08-31
- CAS:3131-63-3
- Min. Order: 1KG
- Purity: 99
- Supply Ability: 1000KG
- 2-Ethylbenzofuran
-
- $6.60 / 1KG
-
2020-01-03
- CAS:3131-63-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg -1000kg
|
| | 2-Ethylbenzofuran Basic information |
| Product Name: | 2-Ethylbenzofuran | | Synonyms: | 2-Ethyl-1-benzofuran;Benzofuran, 2-ethyl-;2-ETHYLBENZOFURAN;2-Ethylbenzofurane;2-Ethylbenzofuran,98%;2-Etyl Benzofuran;2-Ethylcoumarone;2-ETHYLBENZOFURAN 98% | | CAS: | 3131-63-3 | | MF: | C10H10O | | MW: | 146.19 | | EINECS: | 221-524-8 | | Product Categories: | | | Mol File: | 3131-63-3.mol |  |
| | 2-Ethylbenzofuran Chemical Properties |
| Boiling point | 217-218 °C(Press: 742 Torr) | | density | 1.050±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Sparingly) | | form | Oil | | color | Yellow | | InChI | InChI=1S/C10H10O/c1-2-9-7-8-5-3-4-6-10(8)11-9/h3-7H,2H2,1H3 | | InChIKey | KJHYAEZMOHLVCH-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2C=C1CC | | LogP | 3.955 (est) | | CAS DataBase Reference | 3131-63-3(CAS DataBase Reference) | | NIST Chemistry Reference | Ethyl-2-benzofuran(3131-63-3) | | EPA Substance Registry System | Benzofuran, 2-ethyl- (3131-63-3) |
| | 2-Ethylbenzofuran Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow transparent liquid | | Uses | 2-Ethylbenzofuran is used in the synthesis of benzofurans as potential antianginal agents. They are also used in the preparation of 2-arylpyridines that are used in the synthesis of complexes with physical properties. |
| | 2-Ethylbenzofuran Preparation Products And Raw materials |
|