| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
China Langchem Inc. |
| Tel: |
021-58956006,021-58950017 15800617331 |
| Email: |
sales@langchem.com |
|
| | Isobutyric-d6 acid Basic information |
| | Isobutyric-d6 acid Chemical Properties |
| Boiling point | 155.227±8.00 °C(Press: 760.00 Torr)(predicted) | | density | 0.984±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at -20°C | | solubility | DMSO (Soluble), Methanol (Soluble) | | form | Liquid | | pka | 4.847±0.10(predicted) | | color | Colourless | | InChI | InChI=1S/C4H8O2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6)/i1D3,2D3 | | InChIKey | KQNPFQTWMSNSAP-WFGJKAKNSA-N | | SMILES | C(C(=O)O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| | Isobutyric-d6 acid Usage And Synthesis |
| Uses | Isobutyric-d6 Acid is the isotope labelled analogue of Isobutyric Acid, a carboxylic acid found in vanilla. Isobutryic Acid was used as an intermediate in the synthesis of novel inhibitors of signal transducer and activators of transcription 3 signaling pathway. |
| | Isobutyric-d6 acid Preparation Products And Raw materials |
|