| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl 2,3,4-tri-O-benzyl-alpha-D-glucopyranoside Basic information |
| Product Name: | Methyl 2,3,4-tri-O-benzyl-alpha-D-glucopyranoside | | Synonyms: | METHYL 2,3,4-TRI-O-BENZYL-ALFA-D-GLUCOPYRANOSIDE;METHYL 2,3,4-TRI-O-BENZYL-ALPHA-D-GLUCOPYRANOSIDE;Methyl 2,3,4-tris-O-(phenylmethyl)--a-D-glucopyranoside;Methyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside;methyl 4-O-(S)-benzyl-α-d1-2,3-di-O-benzyl-α-D-glucopyranoside;-3,4,5-Tris(benzyloxy);-6-methoxytetrahydro-2H-pyran-2-yl);((2R,3R,4S,5R,6S)-3,4,5-Tris(benzyloxy)-6-methoxytetrahydro-2H-pyran-2-yl)methanol | | CAS: | 53008-65-4 | | MF: | C28H32O6 | | MW: | 464.55 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives;Sugars;Biochemistry;Glucose;Glycosides;O-Substituted Sugars | | Mol File: | 53008-65-4.mol |  |
| | Methyl 2,3,4-tri-O-benzyl-alpha-D-glucopyranoside Chemical Properties |
| Melting point | 67 °C | | Boiling point | 593.0±50.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | refractive index | 24.5 ° (C=1, CHCl3) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 14.48±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]/D 23.0±2.0°, c = 1 in chloroform | | BRN | 1442065 | | InChIKey | MOKYEUQDXDKNDX-FAGPOLGCNA-N | | SMILES | [C@H]1(OCC2C=CC=CC=2)[C@@H](OC)O[C@H](CO)[C@@H](OCC2=CC=CC=C2)[C@@H]1OCC1C=CC=CC=1 |&1:0,9,13,16,25,r| |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | Methyl 2,3,4-tri-O-benzyl-alpha-D-glucopyranoside Usage And Synthesis |
| Uses | Methyl 2,3,4-Tri-O-benzyl-α-D-glucopyranoside (cas# 53008-65-4) is a compound useful in organic synthesis. |
| | Methyl 2,3,4-tri-O-benzyl-alpha-D-glucopyranoside Preparation Products And Raw materials |
|