| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:CK156
|
| Company Name: |
TargetMol
|
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
| Products Intro: |
Product Name:CK156
CAS:2910938-59-7
Package:100mg/RMB 17500;25mg/RMB 10600;50mg/RMB 13800
|
|
| | CK156 Chemical Properties |
| Boiling point | 591.717±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.322±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | pka | 14.774±0.20(predicted) | | form | Solid | | color | White to light yellow | | InChI | 1S/C21H25N5O3/c1-21(2,3)25-20(27)15-5-4-14-12-17(15)29-11-10-28-9-7-22-18-6-8-26-19(24-18)16(14)13-23-26/h4-6,8,12-13H,7,9-11H2,1-3H3,(H,22,24)(H,25,27) | | InChIKey | YCFFONJEHNSECY-UHFFFAOYSA-N | | SMILES | CC(C)(C)NC(C(C=C1)=C(OCCOCCNC2=N3)C=C1C4=C3N(C=C2)N=C4)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | CK156 Usage And Synthesis |
| Biological Activity | CK156 is a potent and selective DRAK1 inhibitor (IC50 = 49 nM by cell-free radiometric assay, IC50 = 181 nM by cellular NanoBRET, KD = 21 nM by ITC, selectivity by a 468-kinase panel) with good selectivity over DRAK2 (61% inhibition at 1 μM, IC50 = 8 μM by NanoBRET). |
| | CK156 Preparation Products And Raw materials |
|