- Cirsilineol
-
- $1220.00
-
2026-04-21
- CAS:41365-32-6
- Purity: 99.89%
- Supply Ability: 10g
|
| | cirsilineol Basic information |
| Product Name: | cirsilineol | | Synonyms: | cirsilineol;2-(4-Hydroxy-3-methoxyphenyl)-5-hydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one;4',5-Dihydroxy-3',6,7-trimethoxyflavone;5,4'-Dihydroxy-6,7,3'-trimethoxyflavone;5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one;Anisomelin;6-Methoxyluteolin 3',7-dimethyl ether;Eupatrin | | CAS: | 41365-32-6 | | MF: | C18H16O7 | | MW: | 344.32 | | EINECS: | | | Product Categories: | | | Mol File: | 41365-32-6.mol |  |
| | cirsilineol Chemical Properties |
| Melting point | 147 °C(Solv: benzene (71-43-2)) | | Boiling point | 585.0±50.0 °C(Predicted) | | density | 1.387 | | storage temp. | -20°C | | solubility | Soluble in DMSO, ethanol and water; | | pka | 6.31±0.40(Predicted) | | form | Solid | | color | Yellow | | Water Solubility | insoluble in water | | BRN | 1355108 | | InChI | InChI=1S/C18H16O7/c1-22-13-6-9(4-5-10(13)19)12-7-11(20)16-14(25-12)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 | | InChIKey | VKOSQMWSWLZQPA-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C(OC)=C2)OC2=CC(OC)=C(OC)C(O)=C2C(=O)C=1 | | LogP | 1.670 (est) |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | cirsilineol Usage And Synthesis |
| Uses | Cirsilineol, a natural flavone compound, selectively inhibits IFN-γ/STAT1/T-bet signaling in intestinal CD4+ T cells. Cirsilineol has potent immunosuppressive and anti-tumor properties. Cirsilineol significantly ameliorates trinitro-benzene sulfonic acid (TNBS)-induced T-cell-mediated experimental colitis in mice[1]. | | Definition | ChEBI: A trimethoxyflavone that is flavone substituted by methoxy groups at positions 6, 7 and 3' and hydroxy groups at positions 5 and 4' respectively. | | in vivo | cirsilineol (3, 10, and 30 mg/kg) significantly ameliorates TNBS-induced Th1-mediated colitis through inhibiting IFN-γ/STAT1/T-bet signaling in CD4+ T cells. | Animal Model: | 8-10-week-old female C57BL/6, BALB/c and DO11.10 transgenic mice with TNBS (10 mg; 100 μL)[1] | | Dosage: | 3, 10, 30 mg/kg | | Administration: | IP; daily; for 11 days | | Result: | Showed a significant improved effect on the body weights and survival rate of mice.
Markedly reduced inflammatory infiltration, restoration of the destructive mucosal architecture and remission of edema.
|
| | target | IFN-γ | IL Receptor | gp120/CD4 | STAT | TGF-β/Smad | JAK | PARP | Caspase | P450 (e.g. CYP17) | | References | [1] Yang Sun, et al. Novel immunomodulatory properties of cirsilineol through selective inhibition of IFN-gamma signaling in a murine model of inflammatory bowel disease. Biochem Pharmacol. 2010 Jan 15;79(2):229-38. DOI:10.1016/j.bcp.2009.08.014 |
| | cirsilineol Preparation Products And Raw materials |
|