|
|
| | 3-Amino-3-cyclopropylpropanoic acid Basic information | | Physical Form |
| Product Name: | 3-Amino-3-cyclopropylpropanoic acid | | Synonyms: | RARECHEM AK HD 0021;3-AMINO-3-CYCLOPROPYL-PROPIONIC ACID;beta-aminocyclopropanepropanoic acid;(R,S)-3-Amino-3-cyclopropylpropanoic acid;3-AMINO-3-CYCLOPROPYLPROPANOIC ACID;DL-3-AMINO-3-CYCLOPROPYL-PROPIONIC ACID;3-amino-3-cyclopropyl-propanoic acid - [A23091] | | CAS: | 331633-72-8 | | MF: | C6H11NO2 | | MW: | 129.16 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 331633-72-8.mol |  |
| | 3-Amino-3-cyclopropylpropanoic acid Chemical Properties |
| Boiling point | 265.073±23.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.246±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 3.635±0.12(predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H11NO2/c7-5(3-6(8)9)4-1-2-4/h4-5H,1-3,7H2,(H,8,9) | | InChIKey | IHWFMMMLMIDKCB-UHFFFAOYSA-N | | SMILES | C1(CC1)C(N)CC(=O)O |
| | 3-Amino-3-cyclopropylpropanoic acid Usage And Synthesis |
| Physical Form | Light yellow to yellow powder or crystals | | Uses | 3-Amino-3-cyclopropylpropanoic acid is a useful research chemical. |
| | 3-Amino-3-cyclopropylpropanoic acid Preparation Products And Raw materials |
|