|
|
| | 2-Ethoxy-6-fluoro-benzonitrile, 98% Basic information |
| | 2-Ethoxy-6-fluoro-benzonitrile, 98% Chemical Properties |
| Melting point | 47-49℃ | | Boiling point | 249℃ | | density | 1.14 | | Fp | 104℃ | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H8FNO/c1-2-12-9-5-3-4-8(10)7(9)6-11/h3-5H,2H2,1H3 | | InChIKey | HVAKERNUWAPZOR-UHFFFAOYSA-N | | SMILES | C(#N)C1=C(F)C=CC=C1OCC |
| HazardClass | IRRITANT | | HS Code | 2926907090 |
| | 2-Ethoxy-6-fluoro-benzonitrile, 98% Usage And Synthesis |
| Chemical Properties | off-white crytalline |
| | 2-Ethoxy-6-fluoro-benzonitrile, 98% Preparation Products And Raw materials |
|