| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 1-hydroxycyclobutane-1-carboxylic acid Basic information | | Physical Form |
| | 1-hydroxycyclobutane-1-carboxylic acid Chemical Properties |
| Melting point | 68 °C(Solv: benzene (71-43-2); ligroine (8032-32-4)) | | Boiling point | 120 °C | | density | 1.476±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.05±0.20(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C5H8O3/c6-4(7)5(8)2-1-3-5/h8H,1-3H2,(H,6,7) | | InChIKey | XCBNHDSVRQZWLH-UHFFFAOYSA-N | | SMILES | C1(O)(C(O)=O)CCC1 |
| | 1-hydroxycyclobutane-1-carboxylic acid Usage And Synthesis |
| Physical Form | Solid | | Uses | 1-Hydroxycyclobutanecarboxylic Acid is used in preparation of piperidines or piperidones substituted with urea and heteroaryl as FPR2 modulators. | | structure and hydrogen bonding |
1-Hydroxy-cyclobutanecarboxylic acid is a potential chelating molecule bearing the conformational rigid cyclobutane group.
| | References | [1] Richard Betz, Peter Klüfers. “1-Hydroxycyclobutane-1-carboxylic acid.” Acta crystallographica. Section E, Structure reports online 63 10 (2007): o4032.
|
| | 1-hydroxycyclobutane-1-carboxylic acid Preparation Products And Raw materials |
|