|
|
| | Benzoic acid, 4-[(1R)-1-aminoethyl]-, methyl ester Basic information |
| | Benzoic acid, 4-[(1R)-1-aminoethyl]-, methyl ester Chemical Properties |
| Boiling point | 281.5±15.0 °C(Predicted) | | density | 1.089±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 8+-.0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C10H13NO2/c1-7(11)8-3-5-9(6-4-8)10(12)13-2/h3-7H,11H2,1-2H3/t7-/m1/s1 | | InChIKey | XSYGLHLLQZGWPT-SSDOTTSWSA-N | | SMILES | C(OC)(=O)C1=CC=C([C@H](N)C)C=C1 |
| | Benzoic acid, 4-[(1R)-1-aminoethyl]-, methyl ester Usage And Synthesis |
| | Benzoic acid, 4-[(1R)-1-aminoethyl]-, methyl ester Preparation Products And Raw materials |
|