|
|
| | 3-(3,4-Dimethoxy-phenyl)-1H-pyrazole-4-carbaldehyde Basic information |
| | 3-(3,4-Dimethoxy-phenyl)-1H-pyrazole-4-carbaldehyde Chemical Properties |
| form | solid | | InChI | 1S/C12H12N2O3/c1-16-10-4-3-8(5-11(10)17-2)12-9(7-15)6-13-14-12/h3-7H,1-2H3,(H,13,14) | | InChIKey | MVOHBLRFSWSWBD-UHFFFAOYSA-N | | SMILES | COC1=CC=C(C=C1OC)C2=C(C=O)C=NN2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 3-(3,4-Dimethoxy-phenyl)-1H-pyrazole-4-carbaldehyde Usage And Synthesis |
| | 3-(3,4-Dimethoxy-phenyl)-1H-pyrazole-4-carbaldehyde Preparation Products And Raw materials |
|