| Company Name: |
Combio (Suzhou) Ltd. Gold |
| Tel: |
17751201929; 17751201929 |
| Email: |
jianyang_yu@combiosz.com |
|
| Product Name: | FALGPA | | Synonyms: | 2-furanacryloyl-leucyl-glycyl-prolyl-alanine;(2S)-3-{2-[(1E)-2-{[(1S)-1-({2-[(2S)-2-{[(1S)-1-carboxyethyl]carbamoyl}pyrrolidin-1-yl]-2-oxoethyl}carbamoyl)-3-methylbutyl]carbamoyl}eth-1-en-1-yl]-1λ3-furan-1-yl}-2-{[(2S)-1-{2-[(2S)-2-[(2E)-3-(furan-2-yl)prop-2-enamido]-4-methylpentanamido]acetyl}pyrro;FA-LEU-GLY-PRO-ALA-OH;FALGPA;N-(3-[2-FURYL]ACRYLOYL)-LEU-GLY-PRO-ALA;N-[3-(2-FURYL)ACRYLOYL]-L-LEUCYL-GLYCYL-L-PROLYL-L-ALANINE;N-{3-(2-Furyl)acryloyl}-L-leucine-glycyl-L-propyl-L-alanine;N-[3-(2-furyl)acryloyl]-leucine-glycine-proline-alanine | | CAS: | 78832-65-2 | | MF: | C23H32N4O7 | | MW: | 476.52 | | EINECS: | 616-657-7 | | Product Categories: | substrate | | Mol File: | 78832-65-2.mol |  |
| | FALGPA Chemical Properties |
| Boiling point | 859.8±65.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | methanol: 50 mg/mL, clear, faintly yellow | | form | powder | | pka | 3.70±0.10(Predicted) | | color | White | | Sequence | FA-Leu-Gly-Pro-Ala-OH | | InChIKey | ZLFQNOJSYZSINX-PVJKAEHXSA-N | | SMILES | CC(C)C[C@H](NC(=O)\C=C\c1ccco1)C(=O)NCC(=O)N2CCC[C@H]2C(=O)N[C@@H](C)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | FALGPA Usage And Synthesis |
| Uses | N-[3-(2-Furyl)acryloyl]-Leu-Gly-Pro-Ala has been used for use in FALGPA assay performed using GBS (Group B Streptococci) USF704. | | General Description | N-[3-(2-Furyl)acryloyl]-Leu-Gly-Pro-Ala or FALGPA is a synthetic substance which resemble the primary structure of collagen, and is hydrolyzed by all known collagenases. | | Biochem/physiol Actions | N-[3-(2-Furyl)acryloyl]-Leu-Gly-Pro-Ala or FALGPA is hydrolyzed by collagenases and the optimum pH for hydrolysis is 7.4. |
| | FALGPA Preparation Products And Raw materials |
|