| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,5-Di-p-tolyl-3-methyl-1,4-pentazadiene Basic information |
| Product Name: | 1,5-Di-p-tolyl-3-methyl-1,4-pentazadiene | | Synonyms: | 3-METHYL-1,5-DI(4-METHYLPHENYL)PENTAZA-1,4-DIENE;3-METHYL-1,5-DI-P-TOLYL-1,4-PENTAZADIENE;3-Methyl-1,5-bis(p-methylphenyl)-1,4-pentazadiene;1,4-Pentazadiene, 3-methyl-1,5-bis(4-methylphenyl)-;3-Methyl-1,5-Di-p-Tolyl-1,4-Pentazadiene pure, 97%;3-Methyl-1,5-di-p-tolyl-1,4-pentazadiene;1,5-Di-p-tolyl-3-methyl-1,4-pentazadiene | | CAS: | 41798-81-6 | | MF: | C15H17N5 | | MW: | 267.33 | | EINECS: | | | Product Categories: | Nitrogen Compounds;Organic Building Blocks;Others | | Mol File: | 41798-81-6.mol |  |
| | 1,5-Di-p-tolyl-3-methyl-1,4-pentazadiene Chemical Properties |
| Melting point | 138-142 °C (lit.) | | InChI | 1S/C15H17N5/c1-12-4-8-14(9-5-12)16-18-20(3)19-17-15-10-6-13(2)7-11-15/h4-11H,1-3H3/b18-16+,19-17+ | | InChIKey | QYJYKVPNNJFJGE-YWNVXTCZSA-N | | SMILES | CN(\N=N\c1ccc(C)cc1)\N=N\c2ccc(C)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,5-Di-p-tolyl-3-methyl-1,4-pentazadiene Usage And Synthesis |
| | 1,5-Di-p-tolyl-3-methyl-1,4-pentazadiene Preparation Products And Raw materials |
|