|
|
| | 3-PHENOXYBENZYL CHLORIDE Basic information |
| | 3-PHENOXYBENZYL CHLORIDE Chemical Properties |
| Boiling point | 141-142 °C (lit.) | | density | 1.189 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5900(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | form | Liquid | | Specific Gravity | 1.16 | | Appearance | Colorless to light yellow Liquid | | Sensitive | Lachrymatory | | BRN | 2212101 | | InChI | InChI=1S/C13H11ClO/c14-10-11-5-4-8-13(9-11)15-12-6-2-1-3-7-12/h1-9H,10H2 | | InChIKey | QUYVTGFWFHQVRO-UHFFFAOYSA-N | | SMILES | C1(CCl)=CC=CC(OC2=CC=CC=C2)=C1 | | CAS DataBase Reference | 53874-66-1(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-27-28-45 | | RIDADR | UN 1760 8/PG 3 | | WGK Germany | 3 | | RTECS | CZ0790000 | | Hazard Note | Corrosive/Lachrymatory | | TSCA | T | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29093090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Corr. 1B | | Toxicity | LD50 orl-rat: 1224 mg/kg GISAAA 56(2),16,91 |
| | 3-PHENOXYBENZYL CHLORIDE Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | 3-Phenoxybenzyl Chloride can be used for antibacterial and mildew-proof down feather protective agents. | | Safety Profile | Moderately toxic by ingestion. A combustible liquid. When heated to decomposition it emits toxic vapors of Clí. |
| | 3-PHENOXYBENZYL CHLORIDE Preparation Products And Raw materials |
|