|
|
| | 2-Bromo-4-(trifluoromethyl)phenylacetonitrile Basic information |
| | 2-Bromo-4-(trifluoromethyl)phenylacetonitrile Chemical Properties |
| Boiling point | 265-266 °C(lit.) | | density | 1.626 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5020(lit.) | | Fp | ≤230 °F | | storage temp. | 2-8°C | | form | liquid | | color | Clear,colourless | | Water Solubility | Slightly soluble in water. | | InChI | 1S/C9H5BrF3N/c10-8-5-7(9(11,12)13)2-1-6(8)3-4-14/h1-2,5H,3H2 | | InChIKey | RYUZTTSDBHOIAF-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(CC#N)c(Br)c1 | | CAS DataBase Reference | 474024-36-7(CAS DataBase Reference) |
| Hazard Codes | T,Xn | | WGK Germany | 3 | | Hazard Note | Toxic | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids |
| | 2-Bromo-4-(trifluoromethyl)phenylacetonitrile Usage And Synthesis |
| Uses | 2-Bromo-4-(trifluoromethyl)phenylacetonitrile is used as pharmaceutical intermediate. |
| | 2-Bromo-4-(trifluoromethyl)phenylacetonitrile Preparation Products And Raw materials |
|