| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride Basic information |
| | Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride Chemical Properties |
| density | 0.92 g/mL at 25 °C(lit.) | | Fp | 1 °F | | form | solid | | Optical Rotation | [α]20/D +5.5°, neat | | InChI | 1S/C18H32B.Li/c1-12-16-10-13(18(16,2)3)11-17(12)19-14-6-4-7-15(19)9-5-8-14;/h12-17,19H,4-11H2,1-3H3;/q-1;+1/t12-,13+,14-,15+,16-,17-,19;/m0./s1 | | InChIKey | JBOSJEWMOTWSER-WWPAYOJJSA-N | | SMILES | [Li+].C[C@@H]1[C@H](C[C@H]2C[C@@H]1C2(C)C)[BH-]3[C@@H]4CCC[C@H]3CCC4 |
| Hazard Codes | F,C | | Risk Statements | 11-14/15-19-20/21/22-34 | | Safety Statements | 16-26-27-36/37/39-45 | | RIDADR | UN 3399 4.3/PG 1 | | WGK Germany | 3 | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Skin Corr. 1B
Water-react 1 |
| | Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride Usage And Synthesis |
| | Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride Preparation Products And Raw materials |
|