| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride Basic information |
| Product Name: | Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride | | Synonyms: | R-ALPINE-HYDRIDE(R);lithium b-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride solution;r-alpine-hydride tm;alpine hydride;(R)-LithiuM isopinocaMpheyl-9-borabicyclo[3.3.1]nonyl hydride;R-alpine-hydride;R-Alpine-Hydride? lithium-S-2,6,6-trimethyl-4-(9-borabicyclo(3.3.1)nonan-9-yl)-bicyclo(3.1.1)heptane hydride;S-lithium-B-isopinocampheyl-9-borabicyclo(3.3.1)nonyl hydride | | CAS: | 64081-12-5 | | MF: | C18H32BLi | | MW: | 266.2 | | EINECS: | | | Product Categories: | | | Mol File: | 64081-12-5.mol | ![Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride Structure](CAS/GIF/64081-12-5.gif) |
| | Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride Chemical Properties |
| density | 0.919 g/mL at 25 °C(lit.) | | Fp | 1 °F | | form | liquid | | Optical Rotation | [α]20/D 8.5° | | InChI | 1S/C18H32B.Li/c1-12-16-10-13(18(16,2)3)11-17(12)19-14-6-4-7-15(19)9-5-8-14;/h12-17,19H,4-11H2,1-3H3;/q-1;+1/t12-,13+,14-,15+,16-,17-,19;/m1./s1 | | InChIKey | JBOSJEWMOTWSER-ZEBZFEJDSA-N | | SMILES | [Li+].C[C@H]1[C@@H](C[C@@H]2C[C@H]1C2(C)C)[BH-]3[C@@H]4CCC[C@H]3CCC4 |
| Hazard Codes | F,C | | Risk Statements | 11-14/15-19-20/21/22-34-40-37 | | Safety Statements | 16-26-27-36/37/39-45-43 | | RIDADR | UN 3399 4.3/PG 1 | | WGK Germany | 3 | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Flam. Liq. 2 Skin Corr. 1B STOT SE 3 Water-react 1 |
| | Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride Usage And Synthesis |
| | Lithium B-isopinocampheyl-9-borabicyclo[3.3.1]nonyl hydride Preparation Products And Raw materials |
|