| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
3,5-Difluorocinnamic acid manufacturers
|
| | 3,5-Difluorocinnamic acid Basic information |
| | 3,5-Difluorocinnamic acid Chemical Properties |
| Melting point | 204-205 °C (lit.) | | Boiling point | 272.0±25.0 °C(Predicted) | | density | 1.379±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 4.15±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C9H6F2O2/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5H,(H,12,13)/b2-1+ | | InChIKey | MBAWRXICVNIUGY-OWOJBTEDSA-N | | SMILES | C(O)(=O)/C=C/C1=CC(F)=CC(F)=C1 | | CAS DataBase Reference | 147700-58-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,5-Difluorocinnamic acid Usage And Synthesis |
| Chemical Properties | white solid | | Uses | 3,5-Difluorocinnamic acid has been used in the synthesis of “unnatural” flavonoids and stilbenes in Escherichia coli. |
| | 3,5-Difluorocinnamic acid Preparation Products And Raw materials |
|