|
|
| | 2-[1-(4-Methoxyphenyl)ethylidene]-1-hydrazinecarboxamide Basic information |
| Product Name: | 2-[1-(4-Methoxyphenyl)ethylidene]-1-hydrazinecarboxamide | | Synonyms: | 2-(1-(4-Methoxyphenyl)ethylidene)hydrazinecarboxamide;Hydrazinecarboxamide, 2-[1-(4-methoxyphenyl)ethylidene]-;2-(1-(4-Methoxyphenyl)ethylidene)hydrazine-1-carboxamide;2-[1-(4-Methoxyphenyl)ethylidene]-1-hydrazinecarboxamide | | CAS: | 717-14-6 | | MF: | C10H13N3O2 | | MW: | 207.23 | | EINECS: | | | Product Categories: | | | Mol File: | 717-14-6.mol | ![2-[1-(4-Methoxyphenyl)ethylidene]-1-hydrazinecarboxamide Structure](CAS/GIF/717-14-6.gif) |
| | 2-[1-(4-Methoxyphenyl)ethylidene]-1-hydrazinecarboxamide Chemical Properties |
| Melting point | 200-202°C | | form | solid | | InChI | 1S/C10H13N3O2/c1-7(12-13-10(11)14)8-3-5-9(15-2)6-4-8/h3-6H,1-2H3,(H3,11,13,14)/b12-7+ | | InChIKey | BDWNPKPUKNYIOF-KPKJPENVSA-N | | SMILES | O=C(N)N/N=C(C)/C1=CC=C(OC)C=C1 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-[1-(4-Methoxyphenyl)ethylidene]-1-hydrazinecarboxamide Usage And Synthesis |
| | 2-[1-(4-Methoxyphenyl)ethylidene]-1-hydrazinecarboxamide Preparation Products And Raw materials |
|