| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Acetaldehyde 2,4-dinitrophenylhydrazone Basic information |
| | Acetaldehyde 2,4-dinitrophenylhydrazone Chemical Properties |
| Melting point | 164°C | | Boiling point | 382.5±42.0 °C(Predicted) | | density | 1.47±0.1 g/cm3(Predicted) | | Fp | 7 °C | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 12.29±0.10(Predicted) | | form | powder or crystals | | Stability: | Hygroscopic | | Major Application | diagnostic assay manufacturing environmental hematology histology | | InChI | 1S/C8H8N4O4/c1-2-9-10-7-4-3-6(11(13)14)5-8(7)12(15)16/h2-5,10H,1H3/b9-2+ | | InChIKey | ONBOQRNOMHHDFB-XNWCZRBMSA-N | | SMILES | C\C=N\Nc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O | | CAS DataBase Reference | 1019-57-4(CAS DataBase Reference) |
| | Acetaldehyde 2,4-dinitrophenylhydrazone Usage And Synthesis |
| Uses | Acetaldehyde 2,4-Dinitrophenylhydrazone is a dinitrophenylhydrazone (DNPH) derivative of an aliphatic alldehyde found in mainstream cigarette smoke. |
| | Acetaldehyde 2,4-dinitrophenylhydrazone Preparation Products And Raw materials |
|