| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Zirconium trifluoroacetylacetonate Basic information |
| | Zirconium trifluoroacetylacetonate Chemical Properties |
| Melting point | 190 °C (dec.)(lit.) | | Boiling point | 235°C | | Fp | 235°C | | form | Powder | | color | white | | Water Solubility | Soluble in toluene. Slightly soluble in THF and methylene chloride. Insoluble in water | | InChI | 1S/4C5H5F3O2.Zr/c4*1-3(9)2-4(10)5(6,7)8;/h4*2,9H,1H3;/q;;;;+4/p-4/b4*3-2-; | | InChIKey | QZQWHIKBKAPMGX-SFFXPQKJSA-J | | SMILES | C\C(O[Zr](O\C(C)=C/C(=O)C(F)(F)F)(O\C(C)=C/C(=O)C(F)(F)F)O\C(C)=C/C(=O)C(F)(F)F)=C\C(=O)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | No | | HS Code | 2915390090 | | Storage Class | 11 - Combustible Solids |
| | Zirconium trifluoroacetylacetonate Usage And Synthesis |
| reaction suitability | core: zirconium |
| | Zirconium trifluoroacetylacetonate Preparation Products And Raw materials |
|