| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Amino-3-chlorobenzotrifluoride Basic information |
| Product Name: | 2-Amino-3-chlorobenzotrifluoride | | Synonyms: | 2-AMINO-1-CHLORO-3-TRIFLUOROMETHYLBENZENE;2-AMINO-3-CHLORO-ALFA,ALFA,ALFA-TRIFLUOROTOLUENE;2-CHLORO-6-TRIFLUOROMETHYLANILINE;2- aMino-3-CL threefluorine toluene;Benzenamine,2-chloro-6-(trifluoromethyl)-;2-AMino-3-chlorobenzotrifluoride[2-Chloro-6-(trifluoroMethyl)aniline];2-Amino-3-chlorobenzotrifluoride >;2-Chloro-6-(trifluoromethyl)aniline[2-Amino-3-chlorobenzotrifluoride] | | CAS: | 433-94-3 | | MF: | C7H5ClF3N | | MW: | 195.57 | | EINECS: | 207-091-8 | | Product Categories: | | | Mol File: | 433-94-3.mol |  |
| | 2-Amino-3-chlorobenzotrifluoride Chemical Properties |
| Boiling point | 39 °C | | density | 1.42 | | refractive index | 1.4960-1.4990 | | Fp | 39-40°C/0.1mm | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -0.48±0.10(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C7H5ClF3N/c8-5-3-1-2-4(6(5)12)7(9,10)11/h1-3H,12H2 | | InChIKey | OTRRSPQJZRCMDA-UHFFFAOYSA-N | | SMILES | C1(N)=C(C(F)(F)F)C=CC=C1Cl | | CAS DataBase Reference | 433-94-3(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-Amino-3-chlorobenzotrifluoride Usage And Synthesis |
| Uses | 2-Chloro-6-(trifluoromethyl)aniline is a molecular determinant for the selective inhibition of cyclooxygenase-2 by lumiracoxib. |
| | 2-Amino-3-chlorobenzotrifluoride Preparation Products And Raw materials |
|