|
|
| | Acetamide-d5 Basic information |
| Product Name: | Acetamide-d5 | | Synonyms: | ACETAMIDE-D5, 99 ATOM % D;ACETAMIDE-D5 99%;Acetamide-d5;Acetamide-d5 | | CAS: | 33675-83-1 | | MF: | C2H5NO | | MW: | 59.07 | | EINECS: | | | Product Categories: | | | Mol File: | 33675-83-1.mol |  |
| | Acetamide-d5 Chemical Properties |
| Melting point | 78-80 °C(lit.) | | Boiling point | 221 °C(lit.) | | solubility | DMSO (Sparingly, Heated), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)/i1D3/hD2 | | InChIKey | DLFVBJFMPXGRIB-OMNVKBNWSA-N | | SMILES | [2H]N([2H])C(=O)C([2H])([2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 36/37 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | Acetamide-d5 Usage And Synthesis |
| Uses | Acetamide-d5 (CAS# 33675-83-1) is a useful isotopically labeled research compound. |
| | Acetamide-d5 Preparation Products And Raw materials |
|