| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2-(4-Chlorophenyl)indole manufacturers
|
| | 2-(4-Chlorophenyl)indole Basic information |
| | 2-(4-Chlorophenyl)indole Chemical Properties |
| Melting point | 203 °C | | Boiling point | 417.8±20.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 16.29±0.30(Predicted) | | InChI | 1S/C14H10ClN/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9,16H | | InChIKey | KDNXKQSAAZNUCK-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)-c2cc3ccccc3[nH]2 | | CAS DataBase Reference | 1211-35-4(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-(4-Chlorophenyl)indole Usage And Synthesis |
| Chemical Properties | Off-white solid | | Synthesis Reference(s) | The Journal of Organic Chemistry, 21, p. 1013, 1956 DOI: 10.1021/jo01115a023 |
| | 2-(4-Chlorophenyl)indole Preparation Products And Raw materials |
|