|
|
| | 2,3,3',4,4',5'-Hexachlorobiphenyl Basic information |
| Product Name: | 2,3,3',4,4',5'-Hexachlorobiphenyl | | Synonyms: | PCB-157;PCB NO 157;BZ NO 157;2,3,3,4,4,5-HEXACHLOROBIPHENYL(5'-ISOMER);1,1'-BIPHENYL,2,3,3',4,4',5'-;CB-157;2,3,3',4,4',5'-Hexachlorobiphenyl 99% (BZ# 157);2,3,3',4,4',5'-Hexachlorobiphenyl(BZ#157),100mg/L,1ml | | CAS: | 69782-90-7 | | MF: | C12H4Cl6 | | MW: | 360.88 | | EINECS: | | | Product Categories: | | | Mol File: | 69782-90-7.mol |  |
| | 2,3,3',4,4',5'-Hexachlorobiphenyl Chemical Properties |
| Melting point | 115.76°C (estimate) | | Boiling point | 446.99°C (rough estimate) | | density | 1.5940 (rough estimate) | | refractive index | 1.6270 (rough estimate) | | Henry's Law Constant | 6.0×10-2 mol/(m3Pa) at 25℃, Fang et al. (2006) | | InChI | InChI=1S/C12H4Cl6/c13-7-2-1-6(10(16)12(7)18)5-3-8(14)11(17)9(15)4-5/h1-4H | | InChIKey | YTWXDQVNPCIEOX-UHFFFAOYSA-N | | SMILES | C1(C2=CC(Cl)=C(Cl)C(Cl)=C2)=CC=C(Cl)C(Cl)=C1Cl | | EPA Substance Registry System | 2,3,3',4,4',5'-Hexachlorobiphenyl (69782-90-7) |
| | 2,3,3',4,4',5'-Hexachlorobiphenyl Usage And Synthesis |
| Uses | 2,3,3'',4,4'',5''-Hexachlorobiphenyl is a polychlorinated biphenyl (PCB) congeners. | | Definition | ChEBI: 2,3,3',4,4',5'-Hexachlorobiphenyl is a trichlorobenzene and a hexachlorobiphenyl. |
| | 2,3,3',4,4',5'-Hexachlorobiphenyl Preparation Products And Raw materials |
|