|
|
| | 2-Amino-4-(4-fluoro-phenyl)-5-methyl-thiophene-3-carboxylic acid ethyl ester Basic information |
| Product Name: | 2-Amino-4-(4-fluoro-phenyl)-5-methyl-thiophene-3-carboxylic acid ethyl ester | | Synonyms: | CHEMBRDG-BB 3000899;AURORA 21213;ethyl 2-amino-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate(SALTDATA: FREE);2-amino-4-(4-fluorophenyl)-5-methyl-3-thiophenecarboxylic acid ethyl ester;3-Thiophenecarboxylic acid, 2-amino-4-(4-fluorophenyl)-5-methyl-;Ethyl 2-amino-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate;3-Thiophenecarboxylic acid, 2-amino-4-(4-fluorophenyl)-5-methyl-, ethyl ester;2-Amino-4-(4-fluoro-phenyl)-5-methyl-thiophene-3-carboxylic acid ethyl ester | | CAS: | 350989-70-7 | | MF: | C14H14FNO2S | | MW: | 279.33 | | EINECS: | | | Product Categories: | | | Mol File: | 350989-70-7.mol |  |
| | 2-Amino-4-(4-fluoro-phenyl)-5-methyl-thiophene-3-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 384.9±42.0 °C(Predicted) | | density | 1.261±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 0.13±0.14(Predicted) | | InChI | 1S/C14H14FNO2S/c1-3-18-14(17)12-11(8(2)19-13(12)16)9-4-6-10(15)7-5-9/h4-7H,3,16H2,1-2H3 | | InChIKey | JKQGEOJZNXXFDI-UHFFFAOYSA-N | | SMILES | NC(S1)=C(C(OCC)=O)C(C2=CC=C(F)C=C2)=C1C |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 2-Amino-4-(4-fluoro-phenyl)-5-methyl-thiophene-3-carboxylic acid ethyl ester Usage And Synthesis |
| | 2-Amino-4-(4-fluoro-phenyl)-5-methyl-thiophene-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|