tert-butyl 3-methoxyphenylcarbamate manufacturers
|
| | tert-butyl 3-methoxyphenylcarbamate Basic information |
| Product Name: | tert-butyl 3-methoxyphenylcarbamate | | Synonyms: | tert-butyl 3-methoxyphenylcarbamate;1-(Boc-amino)-3-methoxybenzene;N-Boc-3-Methoxyaniline;N-Boc-m-anisidine;tert-Butyl (3-methoxyphenyl);(3-Methoxy-phenyl)-carbamic acid tert-butyl ester;Carbamic acid, N-(3-methoxyphenyl)-, 1,1-dimethylethyl ester;N-Boc-3-methoxyaniline 97% | | CAS: | 60144-52-7 | | MF: | C12H17NO3 | | MW: | 223.27 | | EINECS: | | | Product Categories: | | | Mol File: | 60144-52-7.mol |  |
| | tert-butyl 3-methoxyphenylcarbamate Chemical Properties |
| Melting point | 55-60°C | | Fp | >110℃ | | storage temp. | Storage temp. 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C12H17NO3/c1-12(2,3)16-11(14)13-9-6-5-7-10(8-9)15-4/h5-8H,1-4H3,(H,13,14) | | InChIKey | CAJCPYDCXVZYBI-UHFFFAOYSA-N | | SMILES | COc1cccc(NC(=O)OC(C)(C)C)c1 |
| Hazard Codes | Xn | | Risk Statements | 22-36-52 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | tert-butyl 3-methoxyphenylcarbamate Usage And Synthesis |
| | tert-butyl 3-methoxyphenylcarbamate Preparation Products And Raw materials |
|