Epilactose manufacturers
- Epilactose
-
-
2026-09-18
- CAS:20869-27-6
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
- EPILACTOSE
-
- $1.00
-
2020-01-13
- CAS:20869-27-6
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100 kg
|
| | Epilactose Basic information |
| Product Name: | Epilactose | | Synonyms: | 4-O-BETA-GALACTOPYRANOSYL-D-MANNOPYRANOSIDE;4-O-B-galactopyranosyl-D-mannopyranose;2-epi-Lactose;4-O-b-Galactopyranosyl-D-mannopyranoside;4-O-SS-GALACTOPYRANOSYL-D-MANNOPYRANOSIDE;4-O-beta-D-Galactopyranosyl-D-mannopyranose;4-O-(b-D-Galactopyranosyl)-D-mannopyranoside;Lactulose Impurity 1（Lactulose EP Impurity A） | | CAS: | 20869-27-6 | | MF: | C12H22O11 | | MW: | 342.3 | | EINECS: | | | Product Categories: | Oligosaccharides | | Mol File: | 20869-27-6.mol |  |
| | Epilactose Chemical Properties |
| Melting point | 208-210°C | | Boiling point | 667.9±55.0 °C(Predicted) | | density | 1.76±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | H2O: soluble49.00 - 51.00 mg/mL, clear to very slightly hazy, colorless | | form | Solid | | pka | 12.02±0.70(Predicted) | | color | White to Pale Yellow | | Stability: | Hygroscopic | | InChI | InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8+,9-,10-,11+,12+/s3 | | InChIKey | GUBGYTABKSRVRQ-YBDWKALUNA-N | | SMILES | [C@@H]1([C@H](O)[C@@H]([C@@H](O)O[C@@H]1CO)O)O[C@H]1[C@H](O)[C@H]([C@@H](O)[C@@H](CO)O1)O |&1:0,1,3,4,7,12,13,15,16,18,r| |
| WGK Germany | 3 | | HS Code | 29400090 |
| | Epilactose Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An inducer of xylanase and cellulase. | | Definition | ChEBI: Beta-D-Gal-(1->4)-alpha-D-Man is beta-D-Gal-(1->4)-D-Man in which the anomeric configuration of the mannose residue is alpha. |
| | Epilactose Preparation Products And Raw materials |
|