|
|
| | Furanoeudesma-1,3-diene Basic information |
| Product Name: | Furanoeudesma-1,3-diene | | Synonyms: | Naphtho[2,3-b]furan, 4,4a,8a,9-tetrahydro-3,5,8a-trimethyl-, (4aS,8aS)-;Furanoeudesma-1,3-diene | | CAS: | 87605-93-4 | | MF: | C15H18O | | MW: | 214.3 | | EINECS: | | | Product Categories: | | | Mol File: | 87605-93-4.mol |  |
| | Furanoeudesma-1,3-diene Chemical Properties |
| storage temp. | -20°C | | Major Application | food and beverages | | InChIKey | AUSAHAHDEVYCOC-DZGCQCFKSA-N | | SMILES | [o]1c2c(c(c1)C)C[C@@H]3[C@@](C2)(C=CC=C3C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Furanoeudesma-1,3-diene Usage And Synthesis |
| | Furanoeudesma-1,3-diene Preparation Products And Raw materials |
|