L-Methionine p-nitroanilide manufacturers
|
| | L-Methionine p-nitroanilide Basic information |
| | L-Methionine p-nitroanilide Chemical Properties |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | form | powder | | color | white to faint yellow | | InChI | 1S/C11H15N3O3S/c1-18-7-6-10(12)11(15)13-8-2-4-9(5-3-8)14(16)17/h2-5,10H,6-7,12H2,1H3,(H,13,15)/t10-/m0/s1 | | InChIKey | PLBWRAWSHVJPTL-JTQLQIEISA-N | | SMILES | CSCC[C@H](N)C(=O)Nc1ccc(cc1)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Methionine p-nitroanilide Usage And Synthesis |
| Chemical Properties | Light yellow crystalline powder | | Biological Activity | L-Methionine p-nitroanilide is a hMetAP2 substrate. |
| | L-Methionine p-nitroanilide Preparation Products And Raw materials |
|