|
|
| | 2-Amino-4-benzyloxy-5-methoxy-benzoic acid Basic information |
| | 2-Amino-4-benzyloxy-5-methoxy-benzoic acid Chemical Properties |
| Melting point | 159-161℃ | | Boiling point | 462.5±45.0 °C(Predicted) | | density | 1.283±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 2.34±0.10(Predicted) | | Appearance | Light yellow to light brown Solid | | InChI | InChI=1S/C15H15NO4/c1-19-13-7-11(15(17)18)12(16)8-14(13)20-9-10-5-3-2-4-6-10/h2-8H,9,16H2,1H3,(H,17,18) | | InChIKey | CYJFMVXMHCGPSW-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(OC)=C(OCC2=CC=CC=C2)C=C1N |
| | 2-Amino-4-benzyloxy-5-methoxy-benzoic acid Usage And Synthesis |
| | 2-Amino-4-benzyloxy-5-methoxy-benzoic acid Preparation Products And Raw materials |
|