| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1H-Indazole-7-carbaldehyde manufacturers
|
| | 1H-Indazole-7-carbaldehyde Basic information | | Uses |
| | 1H-Indazole-7-carbaldehyde Chemical Properties |
| Boiling point | 358.3±15.0 °C(Predicted) | | density | 1.368±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 12.04±0.40(Predicted) | | form | solid | | color | Light yellow | | InChI | InChI=1S/C8H6N2O/c11-5-7-3-1-2-6-4-9-10-8(6)7/h1-5H,(H,9,10) | | InChIKey | WSCAEUWXSVHQJM-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2C=O)C=N1 |
| | 1H-Indazole-7-carbaldehyde Usage And Synthesis |
| Uses | 1H-indazole-7-carboxaldehyde is a heterocyclic derivative that can be used as an organic intermediate. | | Synthesis | 1H-indazole-7-carboxaldehyde is an aldehyde derivative, which can be obtained from 1H-indazole-7-carboxylic acid by reduction of 1H-indazole-7-carboxylic acid as raw material, and then oxidized to obtain 1H-indazole-7-carboxaldehyde. |
| | 1H-Indazole-7-carbaldehyde Preparation Products And Raw materials |
|