|
|
| | Benzyldecyldimethylammonium chloride Basic information |
| Product Name: | Benzyldecyldimethylammonium chloride | | Synonyms: | Benzenemethanaminium,N-decyl-N,N-dimethyl-,chloride;N-Capryl-N,N-dimethylbenzylammoniumchloride;n-decyl-n,n-dimethyl-benzenemethanaminiuchloride;Decyldimethylbenzylammoniumchloride;Benzyldecyldimethylaminium·chloride;Benzyldimethyldecylaminium·chloride;Decylbenzyldimethylammonium·chloride;Decyldimethylbenzylaminium·chloride | | CAS: | 965-32-2 | | MF: | C19H34ClN | | MW: | 311.93 | | EINECS: | 213-521-5 | | Product Categories: | | | Mol File: | 965-32-2.mol |  |
| | Benzyldecyldimethylammonium chloride Chemical Properties |
| Melting point | 50-60 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | BRN | 3578562 | | Stability: | Hygroscopic | | InChI | 1S/C19H34N.ClH/c1-4-5-6-7-8-9-10-14-17-20(2,3)18-19-15-12-11-13-16-19;/h11-13,15-16H,4-10,14,17-18H2,1-3H3;1H/q+1;/p-1 | | InChIKey | TTZLKXKJIMOHHG-UHFFFAOYSA-M | | SMILES | [Cl-].CCCCCCCCCC[N+](C)(C)Cc1ccccc1 | | EPA Substance Registry System | Benzenemethanaminium, N-decyl-N,N-dimethyl-, chloride (965-32-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | TSCA | TSCA listed | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Dam. 1
Skin Corr. 1B |
| | Benzyldecyldimethylammonium chloride Usage And Synthesis |
| Uses | Benzyldimethyldecylammonium chloride may be used as an analytical reference standard for the determination of the analyte in grapefruit seed extracts, milk samples and food products by chromatography based techniques. | | Uses | Benzyldecyldimethylammonium Chloride is a biocide. | | General Description | Benzyldimethyldecylammonium chloride belongs to the benzalkonium (BAC) group of quaternary ammonium compounds (QACs). It is widely used as an antibacterial and antifungal agent for disinfection purposes. |
| | Benzyldecyldimethylammonium chloride Preparation Products And Raw materials |
|