| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(6-Hydroxyhexyloxy)benzoic acid 4-methoxyphenyl ester Basic information |
| | 4-(6-Hydroxyhexyloxy)benzoic acid 4-methoxyphenyl ester Chemical Properties |
| Melting point | 100 °C | | Boiling point | 517.3±45.0 °C(Predicted) | | density | 1.144±0.06 g/cm3(Predicted) | | pka | 15.17±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C20H24O5/c1-23-17-10-12-19(13-11-17)25-20(22)16-6-8-18(9-7-16)24-15-5-3-2-4-14-21/h6-13,21H,2-5,14-15H2,1H3 | | InChIKey | KTTALHXKXPIECT-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(OC)C=C1)(=O)C1=CC=C(OCCCCCCO)C=C1 |
| | 4-(6-Hydroxyhexyloxy)benzoic acid 4-methoxyphenyl ester Usage And Synthesis |
| | 4-(6-Hydroxyhexyloxy)benzoic acid 4-methoxyphenyl ester Preparation Products And Raw materials |
|