|
|
| | 2-Nitrobenzoyl chloride Basic information |
| | 2-Nitrobenzoyl chloride Chemical Properties |
| Melting point | 17-20 °C (lit.) | | Boiling point | 148-149 °C/9 mmHg (lit.) | | density | 1.404 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.569(lit.) | | Fp | >230 °F | | storage temp. | 0-6°C | | form | Liquid After Melting | | color | Clear yellow to orange to dark brown | | BRN | 777991 | | InChI | 1S/C7H4ClNO3/c8-7(10)5-3-1-2-4-6(5)9(11)12/h1-4H | | InChIKey | BWWHTIHDQBHTHP-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccccc1C(Cl)=O | | CAS DataBase Reference | 610-14-0(CAS DataBase Reference) | | NIST Chemistry Reference | o-Nitrobenzoyl chloride(610-14-0) | | EPA Substance Registry System | o-Nitrobenzoyl chloride (610-14-0) |
| Hazard Codes | C | | Risk Statements | 5-34 | | Safety Statements | 26-36/37/39-45-7/9-38 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | DM6650000 | | F | 4.4-9-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29163990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-Nitrobenzoyl chloride Usage And Synthesis |
| Chemical Properties | CLEAR DARK BROWN LIQUID | | General Description | Crystalline solid. 2-Nitrobenzoyl chloride is shock sensitive. | | Air & Water Reactions | Insoluble in water. Decomposes in water. | | Reactivity Profile | 2-Nitrobenzoyl chloride is incompatible with bases (including amines), with strong oxidizing agents, and with alcohols. May react with reducing agents. May react vigorously or explosively if mixed with diisopropyl ether or other ethers in the presence of trace amounts of metal salts [J. Haz. Mat., 1981, 4, 291]. | | Health Hazard | ACUTE/CHRONIC HAZARDS: 2-Nitrobenzoyl chloride is an irritant to skin, eyes and tissues. | | Fire Hazard | Flash point data is not available for 2-Nitrobenzoyl chloride, but 2-Nitrobenzoyl chloride is probably combustible. |
| | 2-Nitrobenzoyl chloride Preparation Products And Raw materials |
|