|
|
| | 1,2,4,5-Benzenetetrakis(carbonyl chloride) Basic information |
| Product Name: | 1,2,4,5-Benzenetetrakis(carbonyl chloride) | | Synonyms: | 1,2,4,5-Benzenetetracarboxylic acid 1,2,4,5-tetrachloride;1,2,4,5-Benzenetetrakis(carbonyl chloride);Benzene-1,2,4,5-tetracarboxylic acid tetrachloride;Pyromellitic acid chloride;1,2,4,5-BENZENETETRACARBONYL TETRACHLORIDE | | CAS: | 7710-20-5 | | MF: | C10H2Cl4O4 | | MW: | 327.93 | | EINECS: | | | Product Categories: | | | Mol File: | 7710-20-5.mol |  |
| | 1,2,4,5-Benzenetetrakis(carbonyl chloride) Chemical Properties |
| Melting point | 63.4-64.2 °C | | Boiling point | 108-109 °C(Press: 0.008 Torr) | | density | 1.681±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C10H2Cl4O4/c11-7(15)3-1-4(8(12)16)6(10(14)18)2-5(3)9(13)17/h1-2H | | InChIKey | FNGBYWBFWZVPPV-UHFFFAOYSA-N | | SMILES | C1(C(Cl)=O)=CC(C(Cl)=O)=C(C(Cl)=O)C=C1C(Cl)=O | | EPA Substance Registry System | 1,2,4,5-Benzenetetracarbonyl tetrachloride (7710-20-5) |
| | 1,2,4,5-Benzenetetrakis(carbonyl chloride) Usage And Synthesis |
| | 1,2,4,5-Benzenetetrakis(carbonyl chloride) Preparation Products And Raw materials |
|