Muramyl Dipeptide manufacturers
- Muramyl dipeptide
-
- $499.00
-
2026-07-27
- CAS:53678-77-6
- Purity: 98.00%
- Supply Ability: 10g
- Muramyl Dipeptide
-
- $6.00
-
2020-01-10
- CAS:53678-77-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg, 5kg, 50kg
|
| | Muramyl Dipeptide Basic information |
| Product Name: | Muramyl Dipeptide | | Synonyms: | acetylmuramyl-alanyl-isoglutamine;n(sup2)-(n-(n-acetylmuramoyl)-l-alanyl)-d-alpha-glutamin;n(sup2)-(n-(n-acetylmuramoyl)-l-alanyl)-d-alpha-glutamine;Ac-muramyl-Ala-D-Glu-NH;N-AC-MURAMYL-ALA-D-GLU-NH2;N-AC-MURAMYL-ALA-D-GLU-NH2 2H2O;N-ACETYL-MURAMYL-L-ALA-D-ISOGLN;N-ACETYLMURAMYL-L-ALA-D-ISOGLUTAMINE | | CAS: | 53678-77-6 | | MF: | C19H32N4O11 | | MW: | 492.48 | | EINECS: | 258-696-9 | | Product Categories: | | | Mol File: | 53678-77-6.mol |  |
| | Muramyl Dipeptide Chemical Properties |
| Boiling point | 1071.8±65.0 °C(Predicted) | | alpha | D25 +44° (acetic acid) | | density | 1.390±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | H2O: 10 mg/mL, clear, colorless | | pka | 4.44±0.10(Predicted) | | form | buffered aqueous solution | | color | White to off-white | | Merck | 13,6329 | | BRN | 4220745 | | Major Application | cell analysis | | InChIKey | BSOQXXWZTUDTEL-HYUMGUTENA-N | | SMILES | [C@H]1(O[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(=O)N)CCC(=O)O)[C@H](O)[C@H](OC(O)[C@@H]1NC(=O)C)CO |&1:0,2,7,12,21,23,27,r| | | CAS DataBase Reference | 53678-77-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | MA2275260 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | Muramyl Dipeptide Usage And Synthesis |
| Uses | Immunological adjuvant. | | Uses | N-Acetylmuramyl-L-alanyl-D-isoglutamine hydrate has been used in staphylococcal cell wall preparation to induce the release of TNF from human monocytes. | | Biochem/physiol Actions | Muramyl peptides are monomeric components that make up the bacterial cell wall peptidoglycan. It is generally produced by mammalian macrophages, as an immune response in the breakdown of bacterial cell wall. MDP promotes the production of interleukin-1 and tumor necrosis factor (TNF), which increase slow-wave sleep. | | in vivo | Muramyl dipeptide (1.25 mg/kg; i.p.; twice) alleviates bone loss induced by osteoporosis[1]. | Animal Model: | RANKL-induced osteoporosis model (Five-week-old C57BL/6 mice)[1] | | Dosage: | 1.25 mg/kg | | Administration: | i.p.; twice (RANKL-induced osteoporosis for 3 weeks and euthanized at 4 weeks) | | Result: | Significantly enhanced the trabecular bone volume (BV/TV) and trabecular number (Tb.N). |
| | IC 50 | p38 MAPK; NLRP1 |
| | Muramyl Dipeptide Preparation Products And Raw materials |
|