|
|
| | 2-Fluoro-6-hydroxybenzoic acid Basic information |
| | 2-Fluoro-6-hydroxybenzoic acid Chemical Properties |
| Melting point | 159-163 °C (lit.) | | Boiling point | 291.2±25.0 °C(Predicted) | | density | 1.492±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.68±0.25(Predicted) | | color | White to Light yellow to Light orange | | BRN | 7111497 | | InChI | InChI=1S/C7H5FO3/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,9H,(H,10,11) | | InChIKey | BCEKGWWLVKXZKK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(O)C=CC=C1F | | CAS DataBase Reference | 67531-86-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | HS Code | 29181990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 2-Fluoro-6-hydroxybenzoic acid Usage And Synthesis |
| Chemical Properties | White to tan powder |
| | 2-Fluoro-6-hydroxybenzoic acid Preparation Products And Raw materials |
|