|
|
| | 4-Chlorosulfonyl-piperidine-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | 4-Chlorosulfonyl-piperidine-1-carboxylic acid tert-butyl ester | | Synonyms: | tert-butyl4-(chlorosulfonyl)piperidine-;Piperadine-4-sulfonyl chloride, N-Boc protected;1-Boc-4-Chlorosulfonylpiperidine;1-tert-Butyl-4-chlorosulfonylpiperidine;1-Boc-piperidine-4-sulfonyl chloride;1-Boc-4-piperidinesulfonyl Chloride;N-Boc-piperidine-4-sulfonyl chloride;1-Boc-piperidine-4-sulfonyl c | | CAS: | 782501-25-1 | | MF: | C10H18ClNO4S | | MW: | 283.77 | | EINECS: | | | Product Categories: | | | Mol File: | 782501-25-1.mol |  |
| | 4-Chlorosulfonyl-piperidine-1-carboxylic acid tert-butyl ester Chemical Properties |
| Boiling point | 369.5±31.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -3.72±0.40(Predicted) | | form | Powder or Crystalline Powder | | color | White to off-white | | InChI | InChI=1S/C10H18ClNO4S/c1-10(2,3)16-9(13)12-6-4-8(5-7-12)17(11,14)15/h8H,4-7H2,1-3H3 | | InChIKey | VJAHMDQRVLEOFG-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(S(Cl)(=O)=O)CC1 |
| RIDADR | UN3261 | | HazardClass | 8 | | HS Code | 2933399990 |
| | 4-Chlorosulfonyl-piperidine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| | 4-Chlorosulfonyl-piperidine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|