|
|
| | 2,7-Dichloroquinoline-3-carboxaldehyde Basic information |
| Product Name: | 2,7-Dichloroquinoline-3-carboxaldehyde | | Synonyms: | OTAVA-BB 1045291;2,7-Dichloro-3-quinolinecarbaldehyde;2,7-DICHLORO-QUINOLINE-3-CARBALDEHYDE;3-Quinolinecarboxaldehyde, 2,7-dichloro-;2,7-Dichloroquinoline-3-carboxaldehyde | | CAS: | 73568-33-9 | | MF: | C10H5Cl2NO | | MW: | 226.06 | | EINECS: | | | Product Categories: | | | Mol File: | 73568-33-9.mol |  |
| | 2,7-Dichloroquinoline-3-carboxaldehyde Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | color | Yellow | | InChI | 1S/C10H5Cl2NO/c11-8-2-1-6-3-7(5-14)10(12)13-9(6)4-8/h1-5H | | InChIKey | JQJASWYVVSAOBN-UHFFFAOYSA-N | | SMILES | Clc1nc2c(cc1C=O)ccc(c2)Cl |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,7-Dichloroquinoline-3-carboxaldehyde Usage And Synthesis |
| | 2,7-Dichloroquinoline-3-carboxaldehyde Preparation Products And Raw materials |
|