| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | tert-Butyl 3-(iodomethyl)azetidine-1-carboxylate Basic information |
| Product Name: | tert-Butyl 3-(iodomethyl)azetidine-1-carboxylate | | Synonyms: | 1-Boc-3-(iodomethyl)azetidine;1-Boc-3-(iodomethyl)azeti...;N-Boc-3-(iodomethyl)azetidine;3-(iodomethyl)-1-azetidinecarboxylic acid tert-butyl ester;1-Azetidinecarboxylic acid, 3-(iodomethyl)-, 1,1-dimethylethyl ester;1-Boc-3-(iodomethyl)azetidine,95%;tert-Butyl 3-(iodomethyl)azetidine-1-carboxylate - [B0308];tert-Butyl 3-(iodomethyl)azetidine-1-carboxylate | | CAS: | 253176-94-2 | | MF: | C9H16INO2 | | MW: | 297.13 | | EINECS: | | | Product Categories: | | | Mol File: | 253176-94-2.mol |  |
| | tert-Butyl 3-(iodomethyl)azetidine-1-carboxylate Chemical Properties |
| Boiling point | 300.9±15.0 °C(Predicted) | | density | 1.571±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | -2.17±0.40(Predicted) | | form | solid | | color | Light yellow | | InChI | InChI=1S/C9H16INO2/c1-9(2,3)13-8(12)11-5-7(4-10)6-11/h7H,4-6H2,1-3H3 | | InChIKey | CJVGFEARJOREHI-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(CI)C1 |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | tert-Butyl 3-(iodomethyl)azetidine-1-carboxylate Usage And Synthesis |
| | tert-Butyl 3-(iodomethyl)azetidine-1-carboxylate Preparation Products And Raw materials |
|