|
|
| | C10-HOMOSERINE LACTONE Basic information |
| Product Name: | C10-HOMOSERINE LACTONE | | Synonyms: | C10-HSL, N-Decanoyl-L-hoMoserine lactone;Decanoyl-L-hoMoserine lactone;C10-HOMOSERINE LACTONE;N-[(3S)-Tetrahydro-2-oxo-3-furanyl]decanamide;N-[(3S)-2-oxooxolan-3-yl]decanamide;Decanamide, N-[(3S)-tetrahydro-2-oxo-3-furanyl]-;N-Decanoyl-L-homoserine lactone >=96% (HPLC);(S)-N-(2-oxotetrahydrofuran-3-yl)decanamide | | CAS: | 177315-87-6 | | MF: | C14H25NO3 | | MW: | 255.35 | | EINECS: | | | Product Categories: | | | Mol File: | 177315-87-6.mol |  |
| | C10-HOMOSERINE LACTONE Chemical Properties |
| Melting point | 127-130 °C | | Boiling point | 466.1±34.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2) (1:4): 0.2 mg/ml; DMSO: 20 mg/ml | | form | A crystalline solid | | pka | 14.72±0.20(Predicted) | | color | White to off-white | | Optical Rotation | [α]/D -24±3°, c = 0.2 in methanol | | Major Application | cell analysis | | InChI | 1S/C14H25NO3/c1-2-3-4-5-6-7-8-9-13(16)15-12-10-11-18-14(12)17/h12H,2-11H2,1H3,(H,15,16)/t12-/m0/s1 | | InChIKey | TZWZKDULKILUPV-LBPRGKRZSA-N | | SMILES | O=C1OCC[C@@H]1NC(CCCCCCCCC)=O || O=C1OCC[C@@H]1NC(CCCCCCCCC)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | C10-HOMOSERINE LACTONE Usage And Synthesis |
| Uses | Decanoyl-L-homoserine lactone is an active quorum sensing modulator first recognised in Burkholderia pseudomallei. Decanoyl-L-homoserine lactone and other acylhomoserine lactones have been detected in hundreds of bacterial species and, while the homologues vary between species and strains, the homoserine lactones are the major chemical modulators of within and between cell communication and regulation. The most significant variable defining the function of the homoserine lactone is the length of the acyl chain, with shorter chains displaying opposing actions to the longer chains. | | Definition | ChEBI: N-decanoyl-L-Homoserine lactone is a N-acyl-amino acid. | | Biochem/physiol Actions | N-Decanoyl-L-homoserine lactone is a member of N-acyl-homoserine lactone family. N-Acylhomoserine lactones (AHL) regulate gene expression in gram-negative bacteria, such as Echerichia and Salmonella, and are involved in quorum sensing, cell to cell communication among bacteria; for reviews see. Bacterial intercellular communication has become a target for the development of new anti-virulence drugs, and a research focus for the prevention of biofilm formation. |
| | C10-HOMOSERINE LACTONE Preparation Products And Raw materials |
|