|
|
| | (S)-Methyl pyrrolidine-3-carboxylate hydrochloride Basic information |
| Product Name: | (S)-Methyl pyrrolidine-3-carboxylate hydrochloride | | Synonyms: | Methyl (3S)-3-pyrrolidinecarboxylate hydrochloride;methyl (3S)-pyrrolidine-3-carboxylate hydrochloride;(3S)-3-PYRROLIDINECARBOXYLIC ACID METHYL ESTER HCL;S-3-Pyrrolidinecarboxylic acid methyl ester HCL;(S)-Methyl pyrrolidine-3-...;3-Pyrrolidinecarboxylic acid, Methyl ester, hydrochloride, (3S)-;S-3-Pyrrolidinecarboxylic acid Methyl ester hydrochloride;3-Pyrrolidinecarboxylic acid, Methyl ester, hydrochloride (1:1), (3S)- | | CAS: | 1099646-61-3 | | MF: | C6H12ClNO2 | | MW: | 165.62 | | EINECS: | | | Product Categories: | | | Mol File: | 1099646-61-3.mol |  |
| | (S)-Methyl pyrrolidine-3-carboxylate hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1/C6H11NO2.ClH/c1-9-6(8)5-2-3-7-4-5;/h5,7H,2-4H2,1H3;1H/t5-;/s3 | | InChIKey | VVBSXSVVMNGQIN-USHJBNIQNA-N | | SMILES | C([C@@H]1CNCC1)(=O)OC.Cl |&1:1,r| |
| | (S)-Methyl pyrrolidine-3-carboxylate hydrochloride Usage And Synthesis |
| Uses | (S)-Methyl Pyrrolidine-3-carboxylate Hydrochloride is a reagent involved in the discovery of a new small molecule agonist scaffold for the APJ receptor, which may help treat cardiovascular diseases and other disorders. | | Synthesis | The general procedure for the synthesis of methyl S-pyrrolidine-3-carboxylate hydrochloride from methanol and (S)-1-BOC-pyrrolidine-3-carboxylic acid was as follows: to a stirred solution of (3S)-1-{[(1,1-dimethylethyl)oxy]carbonyl}-3-pyrrolidinecarboxylic acid (1.0 g, 4.6 mmol) in methanol (25 mL) was slowly added dropwise, protected by nitrogen and at room temperature, to a stirred solution of Thionyl chloride (1.63 g, 13.7 mmol). The reaction mixture was heated to reflux for 2 hours and subsequently cooled to room temperature. The reaction mixture was concentrated to give 0.766 g (100% yield) of methyl(3S)-3-pyrrolidinecarboxylic acid hydrochloride, initially as an oil, which solidified on standing. The product was characterized by 1H NMR (400 MHz, CDCl3): δ 9.91 (m, 2H), 3.76 (s, 3H), 3.59 (br s, 2H), 3.49 (br s, 2H), 3.28 (br s, 1H), 2.33 (br s, 2H). | | References | [1] Patent: WO2009/5998, 2009, A1. Location in patent: Page/Page column 252-253 |
| | (S)-Methyl pyrrolidine-3-carboxylate hydrochloride Preparation Products And Raw materials |
|