Diethyl cis-cyclopropane-1,2-dicarboxylate manufacturers
|
| | Diethyl cis-cyclopropane-1,2-dicarboxylate Basic information |
| Product Name: | Diethyl cis-cyclopropane-1,2-dicarboxylate | | Synonyms: | cis-Diethyl cyclopropane-1,2-dicarboxylate;cis-cyclopropane-1,2-dicarboxylic acid diethyl ester;cis-1,2-Cyclopropanedicarboxylic acid diethyl ester;Diethyl cis-cyclopropane-1,2-dicarboxylate;1,2-Cyclopropanedicarboxylic acid, 1,2-diethyl ester, (1R,2S)-rel-;Diethyl (1R,2S)-1,2-cyclopropanedicarboxylate | | CAS: | 710-43-0 | | MF: | C9H14O4 | | MW: | 186.21 | | EINECS: | | | Product Categories: | | | Mol File: | 710-43-0.mol |  |
| | Diethyl cis-cyclopropane-1,2-dicarboxylate Chemical Properties |
| Boiling point | 280.69°C (rough estimate) | | density | 1.0620 | | refractive index | 1.4450 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1/C9H14O4/c1-3-12-8(10)6-5-7(6)9(11)13-4-2/h6-7H,3-5H2,1-2H3/t6-,7+ | | InChIKey | SXLDHZFJMXLFJU-KNVOCYPGNA-N | | SMILES | [C@@H]1(C(OCC)=O)C[C@@H]1C(OCC)=O |&1:0,7,r| |
| | Diethyl cis-cyclopropane-1,2-dicarboxylate Usage And Synthesis |
| Uses | Diethyl cis-1,2-Cyclopropanedicarboxylate is used in the synthetic preparation of intermolecular metal-catalyzed carbenoid cyclopropanations. |
| | Diethyl cis-cyclopropane-1,2-dicarboxylate Preparation Products And Raw materials |
|