| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | cis-4-(Boc-amino)cyclohexanecarboxylic acid Basic information |
| | cis-4-(Boc-amino)cyclohexanecarboxylic acid Chemical Properties |
| Melting point | 169°C(lit.) | | Boiling point | 396.7±31.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.89±0.25(Predicted) | | form | Powder | | color | White to off-white | | BRN | 7641071 | | InChI | InChI=1S/C12H21NO4/c1-12(2,3)17-11(16)13-9-6-4-8(5-7-9)10(14)15/h8-9H,4-7H2,1-3H3,(H,13,16)(H,14,15)/t8-,9+ | | InChIKey | KXMRDHPZQHAXML-DTORHVGOSA-N | | SMILES | [C@@H]1(C(O)=O)CC[C@H](NC(OC(C)(C)C)=O)CC1 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 |
| | cis-4-(Boc-amino)cyclohexanecarboxylic acid Usage And Synthesis |
| Chemical Properties | White powder |
| | cis-4-(Boc-amino)cyclohexanecarboxylic acid Preparation Products And Raw materials |
|