|
|
| | 1,1-BIS(METHYLTHIO)-2-NITROETHYLENE Basic information |
| | 1,1-BIS(METHYLTHIO)-2-NITROETHYLENE Chemical Properties |
| Melting point | 125-127 °C(lit.) | | Boiling point | 248.6±35.0 °C(Predicted) | | density | 1.331 (estimate) | | refractive index | 1.5480 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Powder | | color | Yellow | | BRN | 1524538 | | InChI | InChI=1S/C4H7NO2S2/c1-8-4(9-2)3-5(6)7/h3H,1-2H3 | | InChIKey | NXGHEDHQXXXTTP-UHFFFAOYSA-N | | SMILES | C(/SC)(\SC)=C/[N+]([O-])=O | | CAS DataBase Reference | 13623-94-4(CAS DataBase Reference) |
| | 1,1-BIS(METHYLTHIO)-2-NITROETHYLENE Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | Bis(methylthio)-2-nitroethylene is a synthetic intermediate as well as an Impurity of the ulcerostatic agent, Ranitidine (R120000). |
| | 1,1-BIS(METHYLTHIO)-2-NITROETHYLENE Preparation Products And Raw materials |
|