SUC-ALA-ALA-PHE-AMC manufacturers
|
| | SUC-ALA-ALA-PHE-AMC Basic information |
| | SUC-ALA-ALA-PHE-AMC Chemical Properties |
| Boiling point | 1002.6±65.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | 50% acetic acid: 1mg/mL, clear, colorless | | form | Solid | | pka | 4.69±0.10(Predicted) | | color | White to off-white | | InChIKey | HHPVJKZZYOXPLH-UHFFFAOYSA-N | | SMILES | CC(NC(=O)CCC(O)=O)C(=O)NC(C)C(=O)NC(Cc1ccccc1)C(=O)Nc2ccc3C(C)=CC(=O)Oc3c2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | SUC-ALA-ALA-PHE-AMC Usage And Synthesis |
| Uses | N-Succinyl-Ala-Ala-Phe-7-amido-4-methylcoumarin is a fluorescently labeled tripeptide activated with succ-ester. |
| | SUC-ALA-ALA-PHE-AMC Preparation Products And Raw materials |
|