| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Chloro-6-ethoxyquinoline-3-carboxylic acid ethyl ester Basic information |
| | 4-Chloro-6-ethoxyquinoline-3-carboxylic acid ethyl ester Chemical Properties |
| form | solid | | InChI | 1S/C14H14ClNO3/c1-3-18-9-5-6-12-10(7-9)13(15)11(8-16-12)14(17)19-4-2/h5-8H,3-4H2,1-2H3 | | InChIKey | SSOGSEBLCQKKNR-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cnc2ccc(OCC)cc2c1Cl |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-Chloro-6-ethoxyquinoline-3-carboxylic acid ethyl ester Usage And Synthesis |
| | 4-Chloro-6-ethoxyquinoline-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|