| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:2-(Benzyloxy)-1-naphthaldehyde CAS:52805-48-8 Purity:>95% Package:500mg, 1g, 5g
|
|
| | 2-(BENZYLOXY)-1-NAPHTHALDEHYDE Basic information |
| Product Name: | 2-(BENZYLOXY)-1-NAPHTHALDEHYDE | | Synonyms: | ASISCHEM U94827;AKOS AU36-M27;2-(BENZYLOXY)-1-NAPHTHALDEHYDE;OTAVA-BB BB7018801975;2-(Benzyloxy)-1-naphthaldehyde AldrichCPR;1-Naphthalenecarboxaldehyde, 2-(phenylmethoxy)-;2-(benzyloxy)naphthalene-1-carbaldehyde | | CAS: | 52805-48-8 | | MF: | C18H14O2 | | MW: | 262.3 | | EINECS: | | | Product Categories: | | | Mol File: | 52805-48-8.mol |  |
| | 2-(BENZYLOXY)-1-NAPHTHALDEHYDE Chemical Properties |
| Melting point | 121-123°C | | Boiling point | 453.1±20.0 °C(Predicted) | | density | 1.192±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C18H14O2/c19-12-17-16-9-5-4-8-15(16)10-11-18(17)20-13-14-6-2-1-3-7-14/h1-12H,13H2 | | InChIKey | VEMDBXGFPCYWJJ-UHFFFAOYSA-N | | SMILES | O(Cc3ccccc3)c1c(c2c(cc1)cccc2)C=O |
| HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 2-(BENZYLOXY)-1-NAPHTHALDEHYDE Usage And Synthesis |
| Definition | ChEBI: 2-phenylmethoxy-1-naphthalenecarboxaldehyde is a member of naphthalenes. | | Synthesis Reference(s) | Tetrahedron, 53, p. 15029, 1997 DOI: 10.1016/S0040-4020(97)01054-5 |
| | 2-(BENZYLOXY)-1-NAPHTHALDEHYDE Preparation Products And Raw materials |
|