|
|
| | 2-Carboxymethyl-5-methoxy-benzoic acid Basic information |
| Product Name: | 2-Carboxymethyl-5-methoxy-benzoic acid | | Synonyms: | 2-Carboxy-4-methoxybenzeneacetic acid;4-Methoxyhomophthalic acid;Benzeneacetic acid, 2-carboxy-4-methoxy-;2-(carboxymethyl)-5-methoxybenzoicaci;Gliquidone Impurity 1;(S)-N-Fmoc-2-amino-3-(4-hydroxyphenyl)propanoic acid;2-Carboxymethyl-5-methoxy-benzoic acid | | CAS: | 52962-25-1 | | MF: | C10H10O5 | | MW: | 210.18 | | EINECS: | | | Product Categories: | | | Mol File: | 52962-25-1.mol |  |
| | 2-Carboxymethyl-5-methoxy-benzoic acid Chemical Properties |
| storage temp. | 2-8°C | | InChI | InChI=1S/C10H10O5/c1-15-7-3-2-6(4-9(11)12)8(5-7)10(13)14/h2-3,5H,4H2,1H3,(H,11,12)(H,13,14) | | InChIKey | TUJHFMJYEXSKLS-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=C(OC)C=C1C(O)=O |
| | 2-Carboxymethyl-5-methoxy-benzoic acid Usage And Synthesis |
| Uses | 2-(carboxymethyl)-5-methoxybenzoic Acid (cas# 52962-25-1) is used in making heat-developable photographic film with improved storage stability. | | Application | 2-Carboxymethyl-5-methoxy-benzoic acid is applied to the synthesis of 3-Ferrocenyl Isocoumarins and 6-aryl-indenoisoquinolone derivatives dual targeting ERα and VEGFR-2 as anti-breast cancer agents. |
| | 2-Carboxymethyl-5-methoxy-benzoic acid Preparation Products And Raw materials |
|